C19H16ClN5O4S — CID 3127706
2-[[2-acetyl-5-(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide (PubChem CID 3127706) has the molecular formula C19H16ClN5O4S and a molecular weight of 445.89 g/mol. Its IUPAC name is 2-[[2-acetyl-5-(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide.
| Compound Name | 2-[[2-acetyl-5-(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3127706 |
| Molecular Formula | C19H16ClN5O4S |
| Molecular Weight | 445.89 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 2-[[2-acetyl-5-(2-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide |
| SMILES | CC(=O)n1nc(-c2ccccc2Cl)nc1SCC(=O)Nc1ccc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C19H16ClN5O4S/c1-11-9-13(25(28)29)7-8-16(11)21-17(27)10-30-19-22-18(23-24(19)12(2)26)14-5-3-4-6-15(14)20/h3-9H,10H2,1-2H3,(H,21,27) |
| InChIKey | QRBPJUXLGFVNCA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|