C18H13ClN6O3S — CID 55482571
N-(2-chloro-5-nitrophenyl)-2-[(2-methyl-[1,2,4]triazolo[1,5-c]quinazolin-5-yl)sulfanyl]acetamide (PubChem CID 55482571) has the molecular formula C18H13ClN6O3S and a molecular weight of 428.86 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2-[(2-methyl-[1,2,4]triazolo[1,5-c]quinazolin-5-yl)sulfanyl]acetamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2-[(2-methyl-[1,2,4]triazolo[1,5-c]quinazolin-5-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 55482571 |
| Molecular Formula | C18H13ClN6O3S |
| Molecular Weight | 428.86 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2-[(2-methyl-[1,2,4]triazolo[1,5-c]quinazolin-5-yl)sulfanyl]acetamide |
| SMILES | Cc1nc2c3ccccc3nc(SCC(=O)Nc3cc([N+](=O)[O-])ccc3Cl)n2n1 |
| InChI | InChI=1S/C18H13ClN6O3S/c1-10-20-17-12-4-2-3-5-14(12)22-18(24(17)23-10)29-9-16(26)21-15-8-11(25(27)28)6-7-13(15)19/h2-8H,9H2,1H3,(H,21,26) |
| InChIKey | QASVTNZCRDWPAU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.86 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|