C24H16ClN5O4S — CID 3470076
2-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-cyano-4-nitrophenyl)acetamide (PubChem CID 3470076) has the molecular formula C24H16ClN5O4S and a molecular weight of 505.94 g/mol. Its IUPAC name is 2-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-cyano-4-nitrophenyl)acetamide.
| Compound Name | 2-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-cyano-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3470076 |
| Molecular Formula | C24H16ClN5O4S |
| Molecular Weight | 505.94 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | 2-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-cyano-4-nitrophenyl)acetamide |
| SMILES | Cc1c(Cl)cccc1-n1c(SCC(=O)Nc2ccc([N+](=O)[O-])cc2C#N)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H16ClN5O4S/c1-14-18(25)6-4-8-21(14)29-23(32)17-5-2-3-7-20(17)28-24(29)35-13-22(31)27-19-10-9-16(30(33)34)11-15(19)12-26/h2-11H,13H2,1H3,(H,27,31) |
| InChIKey | SFQOJESQKTXLJC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 130.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.94 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|