C25H22ClN3O2S — CID 16532628
2-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-ethylphenyl)acetamide (PubChem CID 16532628) has the molecular formula C25H22ClN3O2S and a molecular weight of 463.99 g/mol. Its IUPAC name is 2-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-ethylphenyl)acetamide.
| Compound Name | 2-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 16532628 |
| Molecular Formula | C25H22ClN3O2S |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 2-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-ethylphenyl)acetamide |
| SMILES | CCc1cccc(NC(=O)CSc2nc3ccccc3c(=O)n2-c2cccc(Cl)c2C)c1 |
| InChI | InChI=1S/C25H22ClN3O2S/c1-3-17-8-6-9-18(14-17)27-23(30)15-32-25-28-21-12-5-4-10-19(21)24(31)29(25)22-13-7-11-20(26)16(22)2/h4-14H,3,15H2,1-2H3,(H,27,30) |
| InChIKey | NHSWKTCOZQQUDZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |