C25H23ClN4O2S — CID 23995737
2-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 23995737) has the molecular formula C25H23ClN4O2S and a molecular weight of 479.01 g/mol. Its IUPAC name is 2-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 23995737 |
| Molecular Formula | C25H23ClN4O2S |
| Molecular Weight | 479.01 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 2-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | Cc1c(Cl)cccc1-n1c(SCC(=O)Nc2ccc(N(C)C)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C25H23ClN4O2S/c1-16-20(26)8-6-10-22(16)30-24(32)19-7-4-5-9-21(19)28-25(30)33-15-23(31)27-17-11-13-18(14-12-17)29(2)3/h4-14H,15H2,1-3H3,(H,27,31) |
| InChIKey | QZFILWCABGNJDM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.01 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|