C25H22N4O4S — CID 16958987
2-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methyl-4-nitrophenyl)acetamide (PubChem CID 16958987) has the molecular formula C25H22N4O4S and a molecular weight of 474.54 g/mol. Its IUPAC name is 2-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methyl-4-nitrophenyl)acetamide.
| Compound Name | 2-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 16958987 |
| Molecular Formula | C25H22N4O4S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 2-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methyl-4-nitrophenyl)acetamide |
| SMILES | Cc1ccc(C)c(-n2c(SCC(=O)Nc3ccc([N+](=O)[O-])cc3C)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C25H22N4O4S/c1-15-8-9-16(2)22(12-15)28-24(31)19-6-4-5-7-21(19)27-25(28)34-14-23(30)26-20-11-10-18(29(32)33)13-17(20)3/h4-13H,14H2,1-3H3,(H,26,30) |
| InChIKey | YXZMZLFFIYTPKB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|