C23H17ClN4O4S — CID 23903462
N-(4-chloro-2-nitrophenyl)-2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 23903462) has the molecular formula C23H17ClN4O4S and a molecular weight of 480.93 g/mol. Its IUPAC name is N-(4-chloro-2-nitrophenyl)-2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(4-chloro-2-nitrophenyl)-2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 23903462 |
| Molecular Formula | C23H17ClN4O4S |
| Molecular Weight | 480.93 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | N-(4-chloro-2-nitrophenyl)-2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)Nc3ccc(Cl)cc3[N+](=O)[O-])nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C23H17ClN4O4S/c1-14-6-9-16(10-7-14)27-22(30)17-4-2-3-5-18(17)26-23(27)33-13-21(29)25-19-11-8-15(24)12-20(19)28(31)32/h2-12H,13H2,1H3,(H,25,29) |
| InChIKey | DXTBNOUYTKJTTE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.93 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|