C24H18ClFN4O5S — CID 4684914
2-[3-(3-chloro-4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(5-methoxy-2-methyl-4-nitrophenyl)acetamide (PubChem CID 4684914) has the molecular formula C24H18ClFN4O5S and a molecular weight of 528.95 g/mol. Its IUPAC name is 2-[3-(3-chloro-4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(5-methoxy-2-methyl-4-nitrophenyl)acetamide.
| Compound Name | 2-[3-(3-chloro-4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(5-methoxy-2-methyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 4684914 |
| Molecular Formula | C24H18ClFN4O5S |
| Molecular Weight | 528.95 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | 2-[3-(3-chloro-4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(5-methoxy-2-methyl-4-nitrophenyl)acetamide |
| SMILES | COc1cc(NC(=O)CSc2nc3ccccc3c(=O)n2-c2ccc(F)c(Cl)c2)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H18ClFN4O5S/c1-13-9-20(30(33)34)21(35-2)11-19(13)27-22(31)12-36-24-28-18-6-4-3-5-15(18)23(32)29(24)14-7-8-17(26)16(25)10-14/h3-11H,12H2,1-2H3,(H,27,31) |
| InChIKey | JSDDVDBYFZOAFY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.95 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|