C25H19F3N4O4S — CID 3654269
2-[3-(2,4-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]acetamide (PubChem CID 3654269) has the molecular formula C25H19F3N4O4S and a molecular weight of 528.51 g/mol. Its IUPAC name is 2-[3-(2,4-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[3-(2,4-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3654269 |
| Molecular Formula | C25H19F3N4O4S |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 2-[3-(2,4-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)Nc3ccc([N+](=O)[O-])cc3C(F)(F)F)nc3ccccc3c2=O)c(C)c1 |
| InChI | InChI=1S/C25H19F3N4O4S/c1-14-7-10-21(15(2)11-14)31-23(34)17-5-3-4-6-19(17)30-24(31)37-13-22(33)29-20-9-8-16(32(35)36)12-18(20)25(26,27)28/h3-12H,13H2,1-2H3,(H,29,33) |
| InChIKey | VSIBTOMEHNELCE-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|