C25H20N6O3S — CID 4670337
N-(4-ethylphenyl)-2-[[2-(4-nitrophenyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]sulfanyl]acetamide (PubChem CID 4670337) has the molecular formula C25H20N6O3S and a molecular weight of 484.54 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-[[2-(4-nitrophenyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]sulfanyl]acetamide.
| Compound Name | N-(4-ethylphenyl)-2-[[2-(4-nitrophenyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4670337 |
| Molecular Formula | C25H20N6O3S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | N-(4-ethylphenyl)-2-[[2-(4-nitrophenyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]sulfanyl]acetamide |
| SMILES | CCc1ccc(NC(=O)CSc2nc3ccccc3c3nc(-c4ccc([N+](=O)[O-])cc4)nn23)cc1 |
| InChI | InChI=1S/C25H20N6O3S/c1-2-16-7-11-18(12-8-16)26-22(32)15-35-25-27-21-6-4-3-5-20(21)24-28-23(29-30(24)25)17-9-13-19(14-10-17)31(33)34/h3-14H,2,15H2,1H3,(H,26,32) |
| InChIKey | FVHHPVQVBDCZLR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|