C27H24N6O5S — CID 4099669
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[2-(3-nitrophenyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]sulfanyl]acetamide (PubChem CID 4099669) has the molecular formula C27H24N6O5S and a molecular weight of 544.59 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[2-(3-nitrophenyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]sulfanyl]acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[2-(3-nitrophenyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4099669 |
| Molecular Formula | C27H24N6O5S |
| Molecular Weight | 544.59 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[2-(3-nitrophenyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(CCNC(=O)CSc2nc3ccccc3c3nc(-c4cccc([N+](=O)[O-])c4)nn23)cc1OC |
| InChI | InChI=1S/C27H24N6O5S/c1-37-22-11-10-17(14-23(22)38-2)12-13-28-24(34)16-39-27-29-21-9-4-3-8-20(21)26-30-25(31-32(26)27)18-6-5-7-19(15-18)33(35)36/h3-11,14-15H,12-13,16H2,1-2H3,(H,28,34) |
| InChIKey | DKACJTXPAYZTMY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 133.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|