C32H30N4O5 — CID 83274888
N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]pyridin-3-yl]propanamide (PubChem CID 83274888) has the molecular formula C32H30N4O5 and a molecular weight of 550.62 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]pyridin-3-yl]propanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]pyridin-3-yl]propanamide |
|---|---|
| PubChem CID | 83274888 |
| Molecular Formula | C32H30N4O5 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]pyridin-3-yl]propanamide |
| SMILES | COc1ccc(CCNC(=O)CCc2c(-c3ccccc3)nc3ccc(-c4cccc([N+](=O)[O-])c4)cn23)cc1OC |
| InChI | InChI=1S/C32H30N4O5/c1-40-28-14-11-22(19-29(28)41-2)17-18-33-31(37)16-13-27-32(23-7-4-3-5-8-23)34-30-15-12-25(21-35(27)30)24-9-6-10-26(20-24)36(38)39/h3-12,14-15,19-21H,13,16-18H2,1-2H3,(H,33,37) |
| InChIKey | DRNXOYODCLWXHU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|