C30H26N4O5 — CID 83285453
N-(3,4-dimethoxyphenyl)-3-[6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]pyridin-3-yl]propanamide (PubChem CID 83285453) has the molecular formula C30H26N4O5 and a molecular weight of 522.56 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-3-[6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]pyridin-3-yl]propanamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-3-[6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]pyridin-3-yl]propanamide |
|---|---|
| PubChem CID | 83285453 |
| Molecular Formula | C30H26N4O5 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-3-[6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]pyridin-3-yl]propanamide |
| SMILES | COc1ccc(NC(=O)CCc2c(-c3ccccc3)nc3ccc(-c4cccc([N+](=O)[O-])c4)cn23)cc1OC |
| InChI | InChI=1S/C30H26N4O5/c1-38-26-14-12-23(18-27(26)39-2)31-29(35)16-13-25-30(20-7-4-3-5-8-20)32-28-15-11-22(19-33(25)28)21-9-6-10-24(17-21)34(36)37/h3-12,14-15,17-19H,13,16H2,1-2H3,(H,31,35) |
| InChIKey | GOQLMDDXJSIGHN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|