C31H27N5O3 — CID 83290005
[4-[(2,6-diphenylimidazo[1,2-a]pyridin-3-yl)methyl]piperazin-1-yl]-(3-nitrophenyl)methanone (PubChem CID 83290005) has the molecular formula C31H27N5O3 and a molecular weight of 517.59 g/mol. Its IUPAC name is [4-[(2,6-diphenylimidazo[1,2-a]pyridin-3-yl)methyl]piperazin-1-yl]-(3-nitrophenyl)methanone.
| Compound Name | [4-[(2,6-diphenylimidazo[1,2-a]pyridin-3-yl)methyl]piperazin-1-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 83290005 |
| Molecular Formula | C31H27N5O3 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | [4-[(2,6-diphenylimidazo[1,2-a]pyridin-3-yl)methyl]piperazin-1-yl]-(3-nitrophenyl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1CCN(Cc2c(-c3ccccc3)nc3ccc(-c4ccccc4)cn23)CC1 |
| InChI | InChI=1S/C31H27N5O3/c37-31(25-12-7-13-27(20-25)36(38)39)34-18-16-33(17-19-34)22-28-30(24-10-5-2-6-11-24)32-29-15-14-26(21-35(28)29)23-8-3-1-4-9-23/h1-15,20-21H,16-19,22H2 |
| InChIKey | GMSFZLIGWMIBLL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|