C32H25F4N5O3 — CID 83279111
[4-[[2-(4-fluorophenyl)-6-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-(3-nitrophenyl)methanone (PubChem CID 83279111) has the molecular formula C32H25F4N5O3 and a molecular weight of 603.58 g/mol. Its IUPAC name is [4-[[2-(4-fluorophenyl)-6-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-(3-nitrophenyl)methanone.
| Compound Name | [4-[[2-(4-fluorophenyl)-6-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 83279111 |
| Molecular Formula | C32H25F4N5O3 |
| Molecular Weight | 603.58 g/mol |
| Exact Mass | 603.19 |
| IUPAC Name | [4-[[2-(4-fluorophenyl)-6-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-(3-nitrophenyl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1CCN(Cc2c(-c3ccc(F)cc3)nc3ccc(-c4cccc(C(F)(F)F)c4)cn23)CC1 |
| InChI | InChI=1S/C32H25F4N5O3/c33-26-10-7-21(8-11-26)30-28(20-38-13-15-39(16-14-38)31(42)23-4-2-6-27(18-23)41(43)44)40-19-24(9-12-29(40)37-30)22-3-1-5-25(17-22)32(34,35)36/h1-12,17-19H,13-16,20H2 |
| InChIKey | HHZZZZPCRQQUGL-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.58 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|