C34H30F3N5O4 — CID 83279176
1-[4-[[2-(3-nitrophenyl)-6-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-2-phenylmethoxyethanone (PubChem CID 83279176) has the molecular formula C34H30F3N5O4 and a molecular weight of 629.64 g/mol. Its IUPAC name is 1-[4-[[2-(3-nitrophenyl)-6-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-2-phenylmethoxyethanone.
| Compound Name | 1-[4-[[2-(3-nitrophenyl)-6-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-2-phenylmethoxyethanone |
|---|---|
| PubChem CID | 83279176 |
| Molecular Formula | C34H30F3N5O4 |
| Molecular Weight | 629.64 g/mol |
| Exact Mass | 629.22 |
| IUPAC Name | 1-[4-[[2-(3-nitrophenyl)-6-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-2-phenylmethoxyethanone |
| SMILES | O=C(COCc1ccccc1)N1CCN(Cc2c(-c3cccc([N+](=O)[O-])c3)nc3ccc(-c4cccc(C(F)(F)F)c4)cn23)CC1 |
| InChI | InChI=1S/C34H30F3N5O4/c35-34(36,37)28-10-4-8-25(18-28)27-12-13-31-38-33(26-9-5-11-29(19-26)42(44)45)30(41(31)20-27)21-39-14-16-40(17-15-39)32(43)23-46-22-24-6-2-1-3-7-24/h1-13,18-20H,14-17,21-23H2 |
| InChIKey | WJLCVDNDOIXOLK-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.64 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|