C31H35N5O3 — CID 83286701
3,3-dimethyl-1-[4-[[6-(3-methylphenyl)-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]butan-1-one (PubChem CID 83286701) has the molecular formula C31H35N5O3 and a molecular weight of 525.65 g/mol. Its IUPAC name is 3,3-dimethyl-1-[4-[[6-(3-methylphenyl)-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]butan-1-one.
| Compound Name | 3,3-dimethyl-1-[4-[[6-(3-methylphenyl)-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 83286701 |
| Molecular Formula | C31H35N5O3 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | 3,3-dimethyl-1-[4-[[6-(3-methylphenyl)-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]butan-1-one |
| SMILES | Cc1cccc(-c2ccc3nc(-c4cccc([N+](=O)[O-])c4)c(CN4CCN(C(=O)CC(C)(C)C)CC4)n3c2)c1 |
| InChI | InChI=1S/C31H35N5O3/c1-22-7-5-8-23(17-22)25-11-12-28-32-30(24-9-6-10-26(18-24)36(38)39)27(35(28)20-25)21-33-13-15-34(16-14-33)29(37)19-31(2,3)4/h5-12,17-18,20H,13-16,19,21H2,1-4H3 |
| InChIKey | MZVJWVHUWPSVET-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|