C31H36N5O3+ — CID 123704842
[3-[3-[[4-(3,3-dimethylbutanoyl)piperazin-1-yl]methyl]-6-phenylimidazo[1,2-a]pyridin-2-yl]phenyl]-methoxy-oxoazanium (PubChem CID 123704842) has the molecular formula C31H36N5O3+ and a molecular weight of 526.66 g/mol. Its IUPAC name is [3-[3-[[4-(3,3-dimethylbutanoyl)piperazin-1-yl]methyl]-6-phenylimidazo[1,2-a]pyridin-2-yl]phenyl]-methoxy-oxoazanium.
| Compound Name | [3-[3-[[4-(3,3-dimethylbutanoyl)piperazin-1-yl]methyl]-6-phenylimidazo[1,2-a]pyridin-2-yl]phenyl]-methoxy-oxoazanium |
|---|---|
| PubChem CID | 123704842 |
| Molecular Formula | C31H36N5O3+ |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | [3-[3-[[4-(3,3-dimethylbutanoyl)piperazin-1-yl]methyl]-6-phenylimidazo[1,2-a]pyridin-2-yl]phenyl]-methoxy-oxoazanium |
| SMILES | CO[N+](=O)c1cccc(-c2nc3ccc(-c4ccccc4)cn3c2CN2CCN(C(=O)CC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C31H36N5O3/c1-31(2,3)20-29(37)34-17-15-33(16-18-34)22-27-30(24-11-8-12-26(19-24)36(38)39-4)32-28-14-13-25(21-35(27)28)23-9-6-5-7-10-23/h5-14,19,21H,15-18,20,22H2,1-4H3/q+1 |
| InChIKey | FDTGSHAWMQYVJK-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|