C28H26F3N5O4 — CID 83274417
2-methoxy-1-[4-[[2-(3-nitrophenyl)-6-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]ethanone (PubChem CID 83274417) has the molecular formula C28H26F3N5O4 and a molecular weight of 553.54 g/mol. Its IUPAC name is 2-methoxy-1-[4-[[2-(3-nitrophenyl)-6-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 2-methoxy-1-[4-[[2-(3-nitrophenyl)-6-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 83274417 |
| Molecular Formula | C28H26F3N5O4 |
| Molecular Weight | 553.54 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | 2-methoxy-1-[4-[[2-(3-nitrophenyl)-6-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]ethanone |
| SMILES | COCC(=O)N1CCN(Cc2c(-c3cccc([N+](=O)[O-])c3)nc3ccc(-c4cccc(C(F)(F)F)c4)cn23)CC1 |
| InChI | InChI=1S/C28H26F3N5O4/c1-40-18-26(37)34-12-10-33(11-13-34)17-24-27(20-5-3-7-23(15-20)36(38)39)32-25-9-8-21(16-35(24)25)19-4-2-6-22(14-19)28(29,30)31/h2-9,14-16H,10-13,17-18H2,1H3 |
| InChIKey | CLAQJHKHUYQXHI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|