C32H29N5O3 — CID 83288876
(4-methylphenyl)-[4-[[2-(3-nitrophenyl)-6-phenylimidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]methanone (PubChem CID 83288876) has the molecular formula C32H29N5O3 and a molecular weight of 531.62 g/mol. Its IUPAC name is (4-methylphenyl)-[4-[[2-(3-nitrophenyl)-6-phenylimidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]methanone.
| Compound Name | (4-methylphenyl)-[4-[[2-(3-nitrophenyl)-6-phenylimidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 83288876 |
| Molecular Formula | C32H29N5O3 |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | (4-methylphenyl)-[4-[[2-(3-nitrophenyl)-6-phenylimidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(Cc3c(-c4cccc([N+](=O)[O-])c4)nc4ccc(-c5ccccc5)cn34)CC2)cc1 |
| InChI | InChI=1S/C32H29N5O3/c1-23-10-12-25(13-11-23)32(38)35-18-16-34(17-19-35)22-29-31(26-8-5-9-28(20-26)37(39)40)33-30-15-14-27(21-36(29)30)24-6-3-2-4-7-24/h2-15,20-21H,16-19,22H2,1H3 |
| InChIKey | HZPMSISAINEZFF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|