C34H33N5O4 — CID 83276161
[4-[[6-(2,5-dimethylphenyl)-2-(3-methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-(3-nitrophenyl)methanone (PubChem CID 83276161) has the molecular formula C34H33N5O4 and a molecular weight of 575.67 g/mol. Its IUPAC name is [4-[[6-(2,5-dimethylphenyl)-2-(3-methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-(3-nitrophenyl)methanone.
| Compound Name | [4-[[6-(2,5-dimethylphenyl)-2-(3-methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 83276161 |
| Molecular Formula | C34H33N5O4 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | [4-[[6-(2,5-dimethylphenyl)-2-(3-methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-(3-nitrophenyl)methanone |
| SMILES | COc1cccc(-c2nc3ccc(-c4cc(C)ccc4C)cn3c2CN2CCN(C(=O)c3cccc([N+](=O)[O-])c3)CC2)c1 |
| InChI | InChI=1S/C34H33N5O4/c1-23-10-11-24(2)30(18-23)27-12-13-32-35-33(25-6-5-9-29(20-25)43-3)31(38(32)21-27)22-36-14-16-37(17-15-36)34(40)26-7-4-8-28(19-26)39(41)42/h4-13,18-21H,14-17,22H2,1-3H3 |
| InChIKey | ZCBJGJQJJXGSCN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|