C35H35N5O4 — CID 83276183
1-[4-[[6-(2,5-dimethylphenyl)-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-2-phenylmethoxyethanone (PubChem CID 83276183) has the molecular formula C35H35N5O4 and a molecular weight of 589.70 g/mol. Its IUPAC name is 1-[4-[[6-(2,5-dimethylphenyl)-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-2-phenylmethoxyethanone.
| Compound Name | 1-[4-[[6-(2,5-dimethylphenyl)-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-2-phenylmethoxyethanone |
|---|---|
| PubChem CID | 83276183 |
| Molecular Formula | C35H35N5O4 |
| Molecular Weight | 589.70 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | 1-[4-[[6-(2,5-dimethylphenyl)-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-2-phenylmethoxyethanone |
| SMILES | Cc1ccc(C)c(-c2ccc3nc(-c4ccc([N+](=O)[O-])cc4)c(CN4CCN(C(=O)COCc5ccccc5)CC4)n3c2)c1 |
| InChI | InChI=1S/C35H35N5O4/c1-25-8-9-26(2)31(20-25)29-12-15-33-36-35(28-10-13-30(14-11-28)40(42)43)32(39(33)21-29)22-37-16-18-38(19-17-37)34(41)24-44-23-27-6-4-3-5-7-27/h3-15,20-21H,16-19,22-24H2,1-2H3 |
| InChIKey | WCZPMOYRLYKGIH-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.70 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|