C33H37N5O4 — CID 98444521
[(1R,3S)-3-methoxycyclohexyl]-[4-[[6-(3-methylphenyl)-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]methanone (PubChem CID 98444521) has the molecular formula C33H37N5O4 and a molecular weight of 567.69 g/mol. Its IUPAC name is [(1R,3S)-3-methoxycyclohexyl]-[4-[[6-(3-methylphenyl)-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]methanone.
| Compound Name | [(1R,3S)-3-methoxycyclohexyl]-[4-[[6-(3-methylphenyl)-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 98444521 |
| Molecular Formula | C33H37N5O4 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | [(1R,3S)-3-methoxycyclohexyl]-[4-[[6-(3-methylphenyl)-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]methanone |
| SMILES | CO[C@H]1CCC[C@@H](C(=O)N2CCN(Cc3c(-c4cccc([N+](=O)[O-])c4)nc4ccc(-c5cccc(C)c5)cn34)CC2)C1 |
| InChI | InChI=1S/C33H37N5O4/c1-23-6-3-7-24(18-23)27-12-13-31-34-32(25-8-4-10-28(19-25)38(40)41)30(37(31)21-27)22-35-14-16-36(17-15-35)33(39)26-9-5-11-29(20-26)42-2/h3-4,6-8,10,12-13,18-19,21,26,29H,5,9,11,14-17,20,22H2,1-2H3/t26-,29+/m1/s1 |
| InChIKey | OGWZMYMMCGRZAU-UHSQPCAPSA-N |
| XLogP | 5.73 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|