C30H30ClN5O3 — CID 83290102
[4-[[6-(3-chlorophenyl)-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-cyclopentylmethanone (PubChem CID 83290102) has the molecular formula C30H30ClN5O3 and a molecular weight of 544.06 g/mol. Its IUPAC name is [4-[[6-(3-chlorophenyl)-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-cyclopentylmethanone.
| Compound Name | [4-[[6-(3-chlorophenyl)-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 83290102 |
| Molecular Formula | C30H30ClN5O3 |
| Molecular Weight | 544.06 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | [4-[[6-(3-chlorophenyl)-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]-cyclopentylmethanone |
| SMILES | O=C(C1CCCC1)N1CCN(Cc2c(-c3ccc([N+](=O)[O-])cc3)nc3ccc(-c4cccc(Cl)c4)cn23)CC1 |
| InChI | InChI=1S/C30H30ClN5O3/c31-25-7-3-6-23(18-25)24-10-13-28-32-29(21-8-11-26(12-9-21)36(38)39)27(35(28)19-24)20-33-14-16-34(17-15-33)30(37)22-4-1-2-5-22/h3,6-13,18-19,22H,1-2,4-5,14-17,20H2 |
| InChIKey | PMVPYVLDHZGEBU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.06 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|