C33H37N5O4 — CID 83277581
(3-methoxycyclohexyl)-[4-[[2-(4-methylphenyl)-6-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]methanone (PubChem CID 83277581) has the molecular formula C33H37N5O4 and a molecular weight of 567.69 g/mol. Its IUPAC name is (3-methoxycyclohexyl)-[4-[[2-(4-methylphenyl)-6-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]methanone.
| Compound Name | (3-methoxycyclohexyl)-[4-[[2-(4-methylphenyl)-6-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 83277581 |
| Molecular Formula | C33H37N5O4 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | (3-methoxycyclohexyl)-[4-[[2-(4-methylphenyl)-6-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]methanone |
| SMILES | COC1CCCC(C(=O)N2CCN(Cc3c(-c4ccc(C)cc4)nc4ccc(-c5cccc([N+](=O)[O-])c5)cn34)CC2)C1 |
| InChI | InChI=1S/C33H37N5O4/c1-23-9-11-24(12-10-23)32-30(22-35-15-17-36(18-16-35)33(39)26-6-4-8-29(20-26)42-2)37-21-27(13-14-31(37)34-32)25-5-3-7-28(19-25)38(40)41/h3,5,7,9-14,19,21,26,29H,4,6,8,15-18,20,22H2,1-2H3 |
| InChIKey | RNVRWMIQWILUCQ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|