C31H28ClN5O5S — CID 91635551
6-(3-chlorophenyl)-3-[[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methyl]-2-(4-nitrophenyl)imidazo[1,2-a]pyridine (PubChem CID 91635551) has the molecular formula C31H28ClN5O5S and a molecular weight of 618.12 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-3-[[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methyl]-2-(4-nitrophenyl)imidazo[1,2-a]pyridine.
| Compound Name | 6-(3-chlorophenyl)-3-[[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methyl]-2-(4-nitrophenyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 91635551 |
| Molecular Formula | C31H28ClN5O5S |
| Molecular Weight | 618.12 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | 6-(3-chlorophenyl)-3-[[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methyl]-2-(4-nitrophenyl)imidazo[1,2-a]pyridine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(Cc3c(-c4ccc([N+](=O)[O-])cc4)nc4ccc(-c5cccc(Cl)c5)cn34)CC2)cc1 |
| InChI | InChI=1S/C31H28ClN5O5S/c1-42-27-10-12-28(13-11-27)43(40,41)35-17-15-34(16-18-35)21-29-31(22-5-8-26(9-6-22)37(38)39)33-30-14-7-24(20-36(29)30)23-3-2-4-25(32)19-23/h2-14,19-20H,15-18,21H2,1H3 |
| InChIKey | DSGICYKSWDMAOG-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.12 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|