C26H23N5O4S2 — CID 42666953
5-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-6-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazole (PubChem CID 42666953) has the molecular formula C26H23N5O4S2 and a molecular weight of 533.64 g/mol. Its IUPAC name is 5-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-6-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-6-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 42666953 |
| Molecular Formula | C26H23N5O4S2 |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 5-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-6-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nc3sccn3c2CN2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)cc1 |
| InChI | InChI=1S/C26H23N5O4S2/c32-31(33)22-8-5-20(6-9-22)25-24(30-15-16-36-26(30)27-25)18-28-11-13-29(14-12-28)37(34,35)23-10-7-19-3-1-2-4-21(19)17-23/h1-10,15-17H,11-14,18H2 |
| InChIKey | IEQWPGAFKSTIEC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|