C31H29N5O5S — CID 83275417
3-[[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methyl]-6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]pyridine (PubChem CID 83275417) has the molecular formula C31H29N5O5S and a molecular weight of 583.67 g/mol. Its IUPAC name is 3-[[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methyl]-6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]pyridine.
| Compound Name | 3-[[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methyl]-6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 83275417 |
| Molecular Formula | C31H29N5O5S |
| Molecular Weight | 583.67 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | 3-[[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methyl]-6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]pyridine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(Cc3c(-c4ccccc4)nc4ccc(-c5cccc([N+](=O)[O-])c5)cn34)CC2)cc1 |
| InChI | InChI=1S/C31H29N5O5S/c1-41-27-11-13-28(14-12-27)42(39,40)34-18-16-33(17-19-34)22-29-31(23-6-3-2-4-7-23)32-30-15-10-25(21-35(29)30)24-8-5-9-26(20-24)36(37)38/h2-15,20-21H,16-19,22H2,1H3 |
| InChIKey | OZADOQJJHBWUIX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.67 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|