C33H31N5O6S — CID 91634339
methyl 2-[[4-[[6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]sulfonylmethyl]benzoate (PubChem CID 91634339) has the molecular formula C33H31N5O6S and a molecular weight of 625.71 g/mol. Its IUPAC name is methyl 2-[[4-[[6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]sulfonylmethyl]benzoate.
| Compound Name | methyl 2-[[4-[[6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]sulfonylmethyl]benzoate |
|---|---|
| PubChem CID | 91634339 |
| Molecular Formula | C33H31N5O6S |
| Molecular Weight | 625.71 g/mol |
| Exact Mass | 625.20 |
| IUPAC Name | methyl 2-[[4-[[6-(3-nitrophenyl)-2-phenylimidazo[1,2-a]pyridin-3-yl]methyl]piperazin-1-yl]sulfonylmethyl]benzoate |
| SMILES | COC(=O)c1ccccc1CS(=O)(=O)N1CCN(Cc2c(-c3ccccc3)nc3ccc(-c4cccc([N+](=O)[O-])c4)cn23)CC1 |
| InChI | InChI=1S/C33H31N5O6S/c1-44-33(39)29-13-6-5-10-27(29)23-45(42,43)36-18-16-35(17-19-36)22-30-32(24-8-3-2-4-9-24)34-31-15-14-26(21-37(30)31)25-11-7-12-28(20-25)38(40)41/h2-15,20-21H,16-19,22-23H2,1H3 |
| InChIKey | DPQVEETXEYHMTQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.71 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|