C26H24N2O4 — CID 18271983
N-(3,4-dimethoxyphenyl)-3-(4,5-diphenyl-1,3-oxazol-2-yl)propanamide (PubChem CID 18271983) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-3-(4,5-diphenyl-1,3-oxazol-2-yl)propanamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-3-(4,5-diphenyl-1,3-oxazol-2-yl)propanamide |
|---|---|
| PubChem CID | 18271983 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-3-(4,5-diphenyl-1,3-oxazol-2-yl)propanamide |
| SMILES | COc1ccc(NC(=O)CCc2nc(-c3ccccc3)c(-c3ccccc3)o2)cc1OC |
| InChI | InChI=1S/C26H24N2O4/c1-30-21-14-13-20(17-22(21)31-2)27-23(29)15-16-24-28-25(18-9-5-3-6-10-18)26(32-24)19-11-7-4-8-12-19/h3-14,17H,15-16H2,1-2H3,(H,27,29) |
| InChIKey | NDVKIOVRDWRATQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |