C28H28N2O4 — CID 41295504
N-(2,5-diethoxyphenyl)-3-(4,5-diphenyl-1,3-oxazol-2-yl)propanamide (PubChem CID 41295504) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-3-(4,5-diphenyl-1,3-oxazol-2-yl)propanamide.
| Compound Name | N-(2,5-diethoxyphenyl)-3-(4,5-diphenyl-1,3-oxazol-2-yl)propanamide |
|---|---|
| PubChem CID | 41295504 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-3-(4,5-diphenyl-1,3-oxazol-2-yl)propanamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)CCc2nc(-c3ccccc3)c(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C28H28N2O4/c1-3-32-22-15-16-24(33-4-2)23(19-22)29-25(31)17-18-26-30-27(20-11-7-5-8-12-20)28(34-26)21-13-9-6-10-14-21/h5-16,19H,3-4,17-18H2,1-2H3,(H,29,31) |
| InChIKey | RKSLZMVIJUSYQI-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |