C21H23NO2 — CID 144634986
4-(4,5-diphenyl-1,3-oxazol-2-yl)butan-2-one;ethane (PubChem CID 144634986) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-(4,5-diphenyl-1,3-oxazol-2-yl)butan-2-one;ethane.
| Compound Name | 4-(4,5-diphenyl-1,3-oxazol-2-yl)butan-2-one;ethane |
|---|---|
| PubChem CID | 144634986 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 4-(4,5-diphenyl-1,3-oxazol-2-yl)butan-2-one;ethane |
| SMILES | CC.CC(=O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C19H17NO2.C2H6/c1-14(21)12-13-17-20-18(15-8-4-2-5-9-15)19(22-17)16-10-6-3-7-11-16;1-2/h2-11H,12-13H2,1H3;1-2H3 |
| InChIKey | KSWZMEPJUQEOTQ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |