C21H19NO4 — CID 157423218
6-(4,5-diphenyl-1,3-oxazol-2-yl)-4-oxohexanoic acid (PubChem CID 157423218) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is 6-(4,5-diphenyl-1,3-oxazol-2-yl)-4-oxohexanoic acid.
| Compound Name | 6-(4,5-diphenyl-1,3-oxazol-2-yl)-4-oxohexanoic acid |
|---|---|
| PubChem CID | 157423218 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 6-(4,5-diphenyl-1,3-oxazol-2-yl)-4-oxohexanoic acid |
| SMILES | O=C(O)CCC(=O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C21H19NO4/c23-17(12-14-19(24)25)11-13-18-22-20(15-7-3-1-4-8-15)21(26-18)16-9-5-2-6-10-16/h1-10H,11-14H2,(H,24,25) |
| InChIKey | NAKPSMPJEPZQKZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |