C18H16N2O3 — CID 177380548
2-[(4,5-diphenyl-1,3-oxazol-2-yl)methylamino]acetic acid (PubChem CID 177380548) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1,3-oxazol-2-yl)methylamino]acetic acid.
| Compound Name | 2-[(4,5-diphenyl-1,3-oxazol-2-yl)methylamino]acetic acid |
|---|---|
| PubChem CID | 177380548 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-[(4,5-diphenyl-1,3-oxazol-2-yl)methylamino]acetic acid |
| SMILES | O=C(O)CNCc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C18H16N2O3/c21-16(22)12-19-11-15-20-17(13-7-3-1-4-8-13)18(23-15)14-9-5-2-6-10-14/h1-10,19H,11-12H2,(H,21,22) |
| InChIKey | JJEHJIBANLWWGL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |