C20H18N2O4 — CID 87486653
2-[(Z)-3-(4,5-diphenyl-1,3-oxazol-2-yl)propylideneamino]oxyacetic acid (PubChem CID 87486653) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-[(Z)-3-(4,5-diphenyl-1,3-oxazol-2-yl)propylideneamino]oxyacetic acid.
| Compound Name | 2-[(Z)-3-(4,5-diphenyl-1,3-oxazol-2-yl)propylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 87486653 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-[(Z)-3-(4,5-diphenyl-1,3-oxazol-2-yl)propylideneamino]oxyacetic acid |
| SMILES | O=C(O)CO/N=C\CCc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C20H18N2O4/c23-18(24)14-25-21-13-7-12-17-22-19(15-8-3-1-4-9-15)20(26-17)16-10-5-2-6-11-16/h1-6,8-11,13H,7,12,14H2,(H,23,24)/b21-13- |
| InChIKey | YUPQWBRZJOVWQY-BKUYFWCQSA-N |
| XLogP | 4.03 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|