C21H18N6O5S — CID 40982292
N-(3,4-dimethoxyphenyl)-2-[[6-(3-nitrophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]sulfanyl]acetamide (PubChem CID 40982292) has the molecular formula C21H18N6O5S and a molecular weight of 466.48 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-[[6-(3-nitrophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-[[6-(3-nitrophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 40982292 |
| Molecular Formula | C21H18N6O5S |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-[[6-(3-nitrophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nnc3ccc(-c4cccc([N+](=O)[O-])c4)nn23)cc1OC |
| InChI | InChI=1S/C21H18N6O5S/c1-31-17-8-6-14(11-18(17)32-2)22-20(28)12-33-21-24-23-19-9-7-16(25-26(19)21)13-4-3-5-15(10-13)27(29)30/h3-11H,12H2,1-2H3,(H,22,28) |
| InChIKey | WHSGCDFGPURSHV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 133.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|