C20H15N5O4S — CID 16821206
1-(4-methoxyphenyl)-2-[[6-(3-nitrophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]sulfanyl]ethanone (PubChem CID 16821206) has the molecular formula C20H15N5O4S and a molecular weight of 421.44 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-[[6-(3-nitrophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]sulfanyl]ethanone.
| Compound Name | 1-(4-methoxyphenyl)-2-[[6-(3-nitrophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 16821206 |
| Molecular Formula | C20H15N5O4S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-[[6-(3-nitrophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]sulfanyl]ethanone |
| SMILES | COc1ccc(C(=O)CSc2nnc3ccc(-c4cccc([N+](=O)[O-])c4)nn23)cc1 |
| InChI | InChI=1S/C20H15N5O4S/c1-29-16-7-5-13(6-8-16)18(26)12-30-20-22-21-19-10-9-17(23-24(19)20)14-3-2-4-15(11-14)25(27)28/h2-11H,12H2,1H3 |
| InChIKey | DJTPAZHFEARICQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|