C21H16N6O5S — CID 16821202
N-(1,3-benzodioxol-5-ylmethyl)-2-[[6-(3-nitrophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]sulfanyl]acetamide (PubChem CID 16821202) has the molecular formula C21H16N6O5S and a molecular weight of 464.46 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[[6-(3-nitrophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]sulfanyl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[[6-(3-nitrophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 16821202 |
| Molecular Formula | C21H16N6O5S |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[[6-(3-nitrophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc2ccc(-c3cccc([N+](=O)[O-])c3)nn12)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H16N6O5S/c28-20(22-10-13-4-6-17-18(8-13)32-12-31-17)11-33-21-24-23-19-7-5-16(25-26(19)21)14-2-1-3-15(9-14)27(29)30/h1-9H,10-12H2,(H,22,28) |
| InChIKey | BLHLEVQHIVCQIN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 133.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|