C23H18N4O5S — CID 4882774
N-(1,3-benzodioxol-5-ylmethyl)-2-(5-nitro-1-phenylbenzimidazol-2-yl)sulfanylacetamide (PubChem CID 4882774) has the molecular formula C23H18N4O5S and a molecular weight of 462.49 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(5-nitro-1-phenylbenzimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(5-nitro-1-phenylbenzimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 4882774 |
| Molecular Formula | C23H18N4O5S |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(5-nitro-1-phenylbenzimidazol-2-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nc2cc([N+](=O)[O-])ccc2n1-c1ccccc1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H18N4O5S/c28-22(24-12-15-6-9-20-21(10-15)32-14-31-20)13-33-23-25-18-11-17(27(29)30)7-8-19(18)26(23)16-4-2-1-3-5-16/h1-11H,12-14H2,(H,24,28) |
| InChIKey | ICPAAJPMSDMFHD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|