C29H25N3O — CID 91634258
N-benzyl-3-(2,6-diphenylimidazo[1,2-a]pyridin-3-yl)propanamide (PubChem CID 91634258) has the molecular formula C29H25N3O and a molecular weight of 431.54 g/mol. Its IUPAC name is N-benzyl-3-(2,6-diphenylimidazo[1,2-a]pyridin-3-yl)propanamide.
| Compound Name | N-benzyl-3-(2,6-diphenylimidazo[1,2-a]pyridin-3-yl)propanamide |
|---|---|
| PubChem CID | 91634258 |
| Molecular Formula | C29H25N3O |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | N-benzyl-3-(2,6-diphenylimidazo[1,2-a]pyridin-3-yl)propanamide |
| SMILES | O=C(CCc1c(-c2ccccc2)nc2ccc(-c3ccccc3)cn12)NCc1ccccc1 |
| InChI | InChI=1S/C29H25N3O/c33-28(30-20-22-10-4-1-5-11-22)19-17-26-29(24-14-8-3-9-15-24)31-27-18-16-25(21-32(26)27)23-12-6-2-7-13-23/h1-16,18,21H,17,19-20H2,(H,30,33) |
| InChIKey | FAYUITQSFBZBJG-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |