C25H25FN4O — CID 53118570
N-[[4-(dimethylamino)phenyl]methyl]-3-[2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]propanamide (PubChem CID 53118570) has the molecular formula C25H25FN4O and a molecular weight of 416.50 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-3-[2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]propanamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-3-[2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]propanamide |
|---|---|
| PubChem CID | 53118570 |
| Molecular Formula | C25H25FN4O |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-3-[2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]propanamide |
| SMILES | CN(C)c1ccc(CNC(=O)CCc2c(-c3ccc(F)cc3)nc3ccccn23)cc1 |
| InChI | InChI=1S/C25H25FN4O/c1-29(2)21-12-6-18(7-13-21)17-27-24(31)15-14-22-25(19-8-10-20(26)11-9-19)28-23-5-3-4-16-30(22)23/h3-13,16H,14-15,17H2,1-2H3,(H,27,31) |
| InChIKey | XOZRFSARGSBPPD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|