C26H23N5O2S — CID 4094647
5-[(4-tert-butylphenyl)methylsulfanyl]-2-(3-nitrophenyl)-[1,2,4]triazolo[1,5-c]quinazoline (PubChem CID 4094647) has the molecular formula C26H23N5O2S and a molecular weight of 469.57 g/mol. Its IUPAC name is 5-[(4-tert-butylphenyl)methylsulfanyl]-2-(3-nitrophenyl)-[1,2,4]triazolo[1,5-c]quinazoline.
| Compound Name | 5-[(4-tert-butylphenyl)methylsulfanyl]-2-(3-nitrophenyl)-[1,2,4]triazolo[1,5-c]quinazoline |
|---|---|
| PubChem CID | 4094647 |
| Molecular Formula | C26H23N5O2S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 5-[(4-tert-butylphenyl)methylsulfanyl]-2-(3-nitrophenyl)-[1,2,4]triazolo[1,5-c]quinazoline |
| SMILES | CC(C)(C)c1ccc(CSc2nc3ccccc3c3nc(-c4cccc([N+](=O)[O-])c4)nn23)cc1 |
| InChI | InChI=1S/C26H23N5O2S/c1-26(2,3)19-13-11-17(12-14-19)16-34-25-27-22-10-5-4-9-21(22)24-28-23(29-30(24)25)18-7-6-8-20(15-18)31(32)33/h4-15H,16H2,1-3H3 |
| InChIKey | KQKSUOCURJRWBB-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|