C22H20N6O4S — CID 4286075
2-[[2-(4-nitrophenyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]sulfanyl]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 4286075) has the molecular formula C22H20N6O4S and a molecular weight of 464.51 g/mol. Its IUPAC name is 2-[[2-(4-nitrophenyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]sulfanyl]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[[2-(4-nitrophenyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]sulfanyl]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4286075 |
| Molecular Formula | C22H20N6O4S |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 2-[[2-(4-nitrophenyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]sulfanyl]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2c2nc(-c3ccc([N+](=O)[O-])cc3)nn12)NCC1CCCO1 |
| InChI | InChI=1S/C22H20N6O4S/c29-19(23-12-16-4-3-11-32-16)13-33-22-24-18-6-2-1-5-17(18)21-25-20(26-27(21)22)14-7-9-15(10-8-14)28(30)31/h1-2,5-10,16H,3-4,11-13H2,(H,23,29) |
| InChIKey | VBSGVRORYBYPNU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|