C21H22N6O6S — CID 42150333
2-[1,3-dimethyl-7-(4-nitrophenyl)-2,4-dioxopyrimido[4,5-d]pyrimidin-5-yl]sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide (PubChem CID 42150333) has the molecular formula C21H22N6O6S and a molecular weight of 486.51 g/mol. Its IUPAC name is 2-[1,3-dimethyl-7-(4-nitrophenyl)-2,4-dioxopyrimido[4,5-d]pyrimidin-5-yl]sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-[1,3-dimethyl-7-(4-nitrophenyl)-2,4-dioxopyrimido[4,5-d]pyrimidin-5-yl]sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 42150333 |
| Molecular Formula | C21H22N6O6S |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 2-[1,3-dimethyl-7-(4-nitrophenyl)-2,4-dioxopyrimido[4,5-d]pyrimidin-5-yl]sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
| SMILES | Cn1c(=O)c2c(SCC(=O)NC[C@@H]3CCCO3)nc(-c3ccc([N+](=O)[O-])cc3)nc2n(C)c1=O |
| InChI | InChI=1S/C21H22N6O6S/c1-25-18-16(20(29)26(2)21(25)30)19(34-11-15(28)22-10-14-4-3-9-33-14)24-17(23-18)12-5-7-13(8-6-12)27(31)32/h5-8,14H,3-4,9-11H2,1-2H3,(H,22,28)/t14-/m0/s1 |
| InChIKey | JSFCDSZXRWMPPS-AWEZNQCLSA-N |
| XLogP | 0.99 |
| TPSA | 151.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|