C22H18N6O5S — CID 40998173
2-(1,3-dimethyl-2,4-dioxo-7-phenylpyrimido[4,5-d]pyrimidin-5-yl)sulfanyl-N-(3-nitrophenyl)acetamide (PubChem CID 40998173) has the molecular formula C22H18N6O5S and a molecular weight of 478.49 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,4-dioxo-7-phenylpyrimido[4,5-d]pyrimidin-5-yl)sulfanyl-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-(1,3-dimethyl-2,4-dioxo-7-phenylpyrimido[4,5-d]pyrimidin-5-yl)sulfanyl-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 40998173 |
| Molecular Formula | C22H18N6O5S |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 2-(1,3-dimethyl-2,4-dioxo-7-phenylpyrimido[4,5-d]pyrimidin-5-yl)sulfanyl-N-(3-nitrophenyl)acetamide |
| SMILES | Cn1c(=O)c2c(SCC(=O)Nc3cccc([N+](=O)[O-])c3)nc(-c3ccccc3)nc2n(C)c1=O |
| InChI | InChI=1S/C22H18N6O5S/c1-26-19-17(21(30)27(2)22(26)31)20(25-18(24-19)13-7-4-3-5-8-13)34-12-16(29)23-14-9-6-10-15(11-14)28(32)33/h3-11H,12H2,1-2H3,(H,23,29) |
| InChIKey | CJRVRWNDBIRGSU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 142.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|