C22H17ClN6O5S — CID 40998217
N-(3-chlorophenyl)-2-[1,3-dimethyl-7-(4-nitrophenyl)-2,4-dioxopyrimido[4,5-d]pyrimidin-5-yl]sulfanylacetamide (PubChem CID 40998217) has the molecular formula C22H17ClN6O5S and a molecular weight of 512.94 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[1,3-dimethyl-7-(4-nitrophenyl)-2,4-dioxopyrimido[4,5-d]pyrimidin-5-yl]sulfanylacetamide.
| Compound Name | N-(3-chlorophenyl)-2-[1,3-dimethyl-7-(4-nitrophenyl)-2,4-dioxopyrimido[4,5-d]pyrimidin-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 40998217 |
| Molecular Formula | C22H17ClN6O5S |
| Molecular Weight | 512.94 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | N-(3-chlorophenyl)-2-[1,3-dimethyl-7-(4-nitrophenyl)-2,4-dioxopyrimido[4,5-d]pyrimidin-5-yl]sulfanylacetamide |
| SMILES | Cn1c(=O)c2c(SCC(=O)Nc3cccc(Cl)c3)nc(-c3ccc([N+](=O)[O-])cc3)nc2n(C)c1=O |
| InChI | InChI=1S/C22H17ClN6O5S/c1-27-19-17(21(31)28(2)22(27)32)20(35-11-16(30)24-14-5-3-4-13(23)10-14)26-18(25-19)12-6-8-15(9-7-12)29(33)34/h3-10H,11H2,1-2H3,(H,24,30) |
| InChIKey | QJRTUMSWBHFZQP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 142.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.94 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|