C21H22N6O5S — CID 40864824
1,3-dimethyl-7-(3-nitrophenyl)-5-(2-oxo-2-piperidin-1-ylethyl)sulfanylpyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 40864824) has the molecular formula C21H22N6O5S and a molecular weight of 470.51 g/mol. Its IUPAC name is 1,3-dimethyl-7-(3-nitrophenyl)-5-(2-oxo-2-piperidin-1-ylethyl)sulfanylpyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-7-(3-nitrophenyl)-5-(2-oxo-2-piperidin-1-ylethyl)sulfanylpyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 40864824 |
| Molecular Formula | C21H22N6O5S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 1,3-dimethyl-7-(3-nitrophenyl)-5-(2-oxo-2-piperidin-1-ylethyl)sulfanylpyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)c2c(SCC(=O)N3CCCCC3)nc(-c3cccc([N+](=O)[O-])c3)nc2n(C)c1=O |
| InChI | InChI=1S/C21H22N6O5S/c1-24-18-16(20(29)25(2)21(24)30)19(33-12-15(28)26-9-4-3-5-10-26)23-17(22-18)13-7-6-8-14(11-13)27(31)32/h6-8,11H,3-5,9-10,12H2,1-2H3 |
| InChIKey | RCDWYIJXZXXJIJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 133.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|