C24H18N4O3S — CID 1338155
2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N-(3-nitrophenyl)acetamide (PubChem CID 1338155) has the molecular formula C24H18N4O3S and a molecular weight of 442.50 g/mol. Its IUPAC name is 2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 1338155 |
| Molecular Formula | C24H18N4O3S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N-(3-nitrophenyl)acetamide |
| SMILES | O=C(CSc1nc(-c2ccccc2)cc(-c2ccccc2)n1)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H18N4O3S/c29-23(25-19-12-7-13-20(14-19)28(30)31)16-32-24-26-21(17-8-3-1-4-9-17)15-22(27-24)18-10-5-2-6-11-18/h1-15H,16H2,(H,25,29) |
| InChIKey | XYOIPAMXBMINTI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|