C12H14N6O4S — CID 139088112
2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(3-nitrophenyl)acetamide;hydrate (PubChem CID 139088112) has the molecular formula C12H14N6O4S and a molecular weight of 338.35 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(3-nitrophenyl)acetamide;hydrate.
| Compound Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(3-nitrophenyl)acetamide;hydrate |
|---|---|
| PubChem CID | 139088112 |
| Molecular Formula | C12H14N6O4S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(3-nitrophenyl)acetamide;hydrate |
| SMILES | Nc1cc(N)nc(SCC(=O)Nc2cccc([N+](=O)[O-])c2)n1.O |
| InChI | InChI=1S/C12H12N6O3S.H2O/c13-9-5-10(14)17-12(16-9)22-6-11(19)15-7-2-1-3-8(4-7)18(20)21;/h1-5H,6H2,(H,15,19)(H4,13,14,16,17);1H2 |
| InChIKey | RJSLHWNKBLOIJC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 181.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|