C12H12N6O3S — CID 3138497
2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2-nitrophenyl)acetamide (PubChem CID 3138497) has the molecular formula C12H12N6O3S and a molecular weight of 320.33 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3138497 |
| Molecular Formula | C12H12N6O3S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2-nitrophenyl)acetamide |
| SMILES | Nc1cc(N)nc(SCC(=O)Nc2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C12H12N6O3S/c13-9-5-10(14)17-12(16-9)22-6-11(19)15-7-3-1-2-4-8(7)18(20)21/h1-5H,6H2,(H,15,19)(H4,13,14,16,17) |
| InChIKey | USXFVAOETRKTCF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 150.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|